(3AS,6aR)-6-methoxy-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxylic acid - Names and Identifiers
Name | 2,3-O-Isopropylidene-1-O-methyl-D-ribosic acid
|
Synonyms | 2,3-O-Isopropylidene-1-O-methyl-D-ribosic acid 2,3-O-ISOPROPYLIDENE-1-O-METHYL-D-RIBOSIC ACID methyl 2,3-o-isopropylidene-á-d-ribofuranosiduronic acid Methyl 2,3-O-isopropylidene-beta-D-ribofuranosiduronic acid methyl 2,3-O-(1-methylethylidene)-beta-D-ribofuranosiduronic acid 1-Methoxy-2,3-O-isopropylidene-β-D-ribofuranosyl-5-carboxylic acid (3AS,6aR)-6-methoxy-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxylic acid (3AS,6R,6AR)-6-Methoxy-2,2-dimethyl-tetrahydro-furo[3,4-d][1,3]dioxole-4-carboxylic acid (3aS,4S,6R,6aR)-6-Methoxy-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxylic acid
|
CAS | 54622-95-6
|
InChI | InChI=1/C9H14O6/c1-9(2)14-4-5(7(10)11)13-8(12-3)6(4)15-9/h4-6,8H,1-3H3,(H,10,11)/t4-,5+,6-,8-/m1/s1 |
(3AS,6aR)-6-methoxy-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxylic acid - Physico-chemical Properties
Molecular Formula | C9H14O6
|
Molar Mass | 218.2 |
Density | 1.34±0.1 g/cm3(Predicted) |
Melting Point | 129-130°C |
Boling Point | 341.6±42.0 °C(Predicted) |
Flash Point | 135.064°C |
Solubility | Soluble in methanol. |
Vapor Presure | 0mmHg at 25°C |
pKa | 2.67±0.60(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.504 |
MDL | MFCD01632660 |
(3AS,6aR)-6-methoxy-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxylic acid - Risk and Safety
Safety Description | S22 - Do not breathe dust.
S24/25 - Avoid contact with skin and eyes.
|
(3AS,6aR)-6-methoxy-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxylic acid - Introduction
2. The acronym IOXMe is an organic compound usually used as its chemical formula. The following is a detailed description of the properties, uses, preparation and safety information of the compound:
1. nature:
-Appearance: 2, acid is a colorless crystalline solid.
-Solubility: Low solubility in water, but better solubility in organic solvents.
-Stability: The compound is relatively stable at room temperature.
2. use:
-Chemical synthesis: 2. acid is often used in organic chemical synthesis as an important reagent.
-Sugar analysis: This compound can be used for sugar analysis and quantitative determination.
3. Preparation method:
-Generally, 2, acid can be synthesized by the following steps:
a) first, D-ribonic acid is reacted by protecting group to introduce protecting group of o-methyl group and o-isopropylene group;
B) Then, the protecting group is oxidized to convert it into 2, acid.
4. Safety Information:
- 2, acid generally does not cause direct harm to the human body during use and storage.
-However, any chemical substances should be used with caution, avoid skin contact and inhalation, and ensure that the operation is in a well-ventilated environment.
-If ingested by mistake or other accidents occur, seek medical advice.
Last Update:2024-04-10 22:29:15